C14H20N2O5 — CID 70523631
4-(3-aminopropyl)-N,N-dimethylbenzamide;oxalic acid (PubChem CID 70523631) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 4-(3-aminopropyl)-N,N-dimethylbenzamide;oxalic acid.
| Compound Name | 4-(3-aminopropyl)-N,N-dimethylbenzamide;oxalic acid |
|---|---|
| PubChem CID | 70523631 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-(3-aminopropyl)-N,N-dimethylbenzamide;oxalic acid |
| SMILES | CN(C)C(=O)c1ccc(CCCN)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H18N2O.C2H2O4/c1-14(2)12(15)11-7-5-10(6-8-11)4-3-9-13;3-1(4)2(5)6/h5-8H,3-4,9,13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | NIPHWHJTCZBVNB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|