C22H28N2O2 — CID 46422120
4-[[[2-(4-butylphenyl)acetyl]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 46422120) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 4-[[[2-(4-butylphenyl)acetyl]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[2-(4-butylphenyl)acetyl]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 46422120 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 4-[[[2-(4-butylphenyl)acetyl]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCCCc1ccc(CC(=O)NCc2ccc(C(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-4-5-6-17-7-9-18(10-8-17)15-21(25)23-16-19-11-13-20(14-12-19)22(26)24(2)3/h7-14H,4-6,15-16H2,1-3H3,(H,23,25) |
| InChIKey | QCHVWQFQWGHYGK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |