C17H25NO3 — CID 81369144
3-[[2-(4-butylphenyl)acetyl]amino]-2,2-dimethylpropanoic acid (PubChem CID 81369144) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-[[2-(4-butylphenyl)acetyl]amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[2-(4-butylphenyl)acetyl]amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 81369144 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 3-[[2-(4-butylphenyl)acetyl]amino]-2,2-dimethylpropanoic acid |
| SMILES | CCCCc1ccc(CC(=O)NCC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-4-5-6-13-7-9-14(10-8-13)11-15(19)18-12-17(2,3)16(20)21/h7-10H,4-6,11-12H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | HPSHOWUEEOWEMZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |