C17H26N2O2 — CID 56813745
3-[[2-(4-butylphenyl)acetyl]amino]-2,2-dimethylpropanamide (PubChem CID 56813745) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-[[2-(4-butylphenyl)acetyl]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[2-(4-butylphenyl)acetyl]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 56813745 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 3-[[2-(4-butylphenyl)acetyl]amino]-2,2-dimethylpropanamide |
| SMILES | CCCCc1ccc(CC(=O)NCC(C)(C)C(N)=O)cc1 |
| InChI | InChI=1S/C17H26N2O2/c1-4-5-6-13-7-9-14(10-8-13)11-15(20)19-12-17(2,3)16(18)21/h7-10H,4-6,11-12H2,1-3H3,(H2,18,21)(H,19,20) |
| InChIKey | RJPQSANDGBIMEY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |