C11H12ClF2NO3S — CID 91661460
2-chloro-2,2-difluoro-N-[2-(4-methylsulfonylphenyl)ethyl]acetamide (PubChem CID 91661460) has the molecular formula C11H12ClF2NO3S and a molecular weight of 311.74 g/mol. Its IUPAC name is 2-chloro-2,2-difluoro-N-[2-(4-methylsulfonylphenyl)ethyl]acetamide.
| Compound Name | 2-chloro-2,2-difluoro-N-[2-(4-methylsulfonylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 91661460 |
| Molecular Formula | C11H12ClF2NO3S |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 2-chloro-2,2-difluoro-N-[2-(4-methylsulfonylphenyl)ethyl]acetamide |
| SMILES | CS(=O)(=O)c1ccc(CCNC(=O)C(F)(F)Cl)cc1 |
| InChI | InChI=1S/C11H12ClF2NO3S/c1-19(17,18)9-4-2-8(3-5-9)6-7-15-10(16)11(12,13)14/h2-5H,6-7H2,1H3,(H,15,16) |
| InChIKey | KJPQRDNDCJXQHJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|