C22H27NO3S — CID 72629224
4-(3,3-dimethylbut-1-enyl)-N-[2-(4-methylsulfonylphenyl)ethyl]benzamide (PubChem CID 72629224) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is 4-(3,3-dimethylbut-1-enyl)-N-[2-(4-methylsulfonylphenyl)ethyl]benzamide.
| Compound Name | 4-(3,3-dimethylbut-1-enyl)-N-[2-(4-methylsulfonylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 72629224 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-(3,3-dimethylbut-1-enyl)-N-[2-(4-methylsulfonylphenyl)ethyl]benzamide |
| SMILES | CC(C)(C)C=Cc1ccc(C(=O)NCCc2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H27NO3S/c1-22(2,3)15-13-17-5-9-19(10-6-17)21(24)23-16-14-18-7-11-20(12-8-18)27(4,25)26/h5-13,15H,14,16H2,1-4H3,(H,23,24) |
| InChIKey | MHHNEPHLFVVEHW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |