C20H22FNO — CID 59811458
4-[(E)-3,3-dimethylbut-1-enyl]-N-[(3-fluorophenyl)methyl]benzamide (PubChem CID 59811458) has the molecular formula C20H22FNO and a molecular weight of 311.40 g/mol. Its IUPAC name is 4-[(E)-3,3-dimethylbut-1-enyl]-N-[(3-fluorophenyl)methyl]benzamide.
| Compound Name | 4-[(E)-3,3-dimethylbut-1-enyl]-N-[(3-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 59811458 |
| Molecular Formula | C20H22FNO |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 4-[(E)-3,3-dimethylbut-1-enyl]-N-[(3-fluorophenyl)methyl]benzamide |
| SMILES | CC(C)(C)/C=C/c1ccc(C(=O)NCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C20H22FNO/c1-20(2,3)12-11-15-7-9-17(10-8-15)19(23)22-14-16-5-4-6-18(21)13-16/h4-13H,14H2,1-3H3,(H,22,23)/b12-11+ |
| InChIKey | OZJOCPABUGMTTL-VAWYXSNFSA-N |
| XLogP | 4.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |