C20H23NO — CID 85424416
N-benzyl-4-(3,3-dimethylbut-1-enyl)benzamide (PubChem CID 85424416) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is N-benzyl-4-(3,3-dimethylbut-1-enyl)benzamide.
| Compound Name | N-benzyl-4-(3,3-dimethylbut-1-enyl)benzamide |
|---|---|
| PubChem CID | 85424416 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-benzyl-4-(3,3-dimethylbut-1-enyl)benzamide |
| SMILES | CC(C)(C)C=Cc1ccc(C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO/c1-20(2,3)14-13-16-9-11-18(12-10-16)19(22)21-15-17-7-5-4-6-8-17/h4-14H,15H2,1-3H3,(H,21,22) |
| InChIKey | WQXWQSBQNHNCPZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |