C19H20ClNO — CID 72771533
N-(2-chlorophenyl)-4-(3,3-dimethylbut-1-enyl)benzamide (PubChem CID 72771533) has the molecular formula C19H20ClNO and a molecular weight of 313.83 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-(3,3-dimethylbut-1-enyl)benzamide.
| Compound Name | N-(2-chlorophenyl)-4-(3,3-dimethylbut-1-enyl)benzamide |
|---|---|
| PubChem CID | 72771533 |
| Molecular Formula | C19H20ClNO |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-(2-chlorophenyl)-4-(3,3-dimethylbut-1-enyl)benzamide |
| SMILES | CC(C)(C)C=Cc1ccc(C(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO/c1-19(2,3)13-12-14-8-10-15(11-9-14)18(22)21-17-7-5-4-6-16(17)20/h4-13H,1-3H3,(H,21,22) |
| InChIKey | PNFWVIKOVZKUEF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |