C21H25NO2 — CID 11529895
4-[(E)-3,3-dimethylbut-1-enyl]-N-[2-(2-hydroxyethyl)phenyl]benzamide (PubChem CID 11529895) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-[(E)-3,3-dimethylbut-1-enyl]-N-[2-(2-hydroxyethyl)phenyl]benzamide.
| Compound Name | 4-[(E)-3,3-dimethylbut-1-enyl]-N-[2-(2-hydroxyethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 11529895 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 4-[(E)-3,3-dimethylbut-1-enyl]-N-[2-(2-hydroxyethyl)phenyl]benzamide |
| SMILES | CC(C)(C)/C=C/c1ccc(C(=O)Nc2ccccc2CCO)cc1 |
| InChI | InChI=1S/C21H25NO2/c1-21(2,3)14-12-16-8-10-18(11-9-16)20(24)22-19-7-5-4-6-17(19)13-15-23/h4-12,14,23H,13,15H2,1-3H3,(H,22,24)/b14-12+ |
| InChIKey | VTCUGPBUXPIDOH-WYMLVPIESA-N |
| XLogP | 4.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |