C13H17NO3S — CID 110790600
N-[2-(4-methylsulfonylphenyl)ethyl]cyclopropanecarboxamide (PubChem CID 110790600) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-[2-(4-methylsulfonylphenyl)ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-(4-methylsulfonylphenyl)ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 110790600 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-[2-(4-methylsulfonylphenyl)ethyl]cyclopropanecarboxamide |
| SMILES | CS(=O)(=O)c1ccc(CCNC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C13H17NO3S/c1-18(16,17)12-6-2-10(3-7-12)8-9-14-13(15)11-4-5-11/h2-3,6-7,11H,4-5,8-9H2,1H3,(H,14,15) |
| InChIKey | RHUGJRKHYRBGSI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |