C18H25NO3 — CID 120673281
4-[2-(4-ethylphenyl)ethylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120673281) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 4-[2-(4-ethylphenyl)ethylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[2-(4-ethylphenyl)ethylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120673281 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 4-[2-(4-ethylphenyl)ethylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CCc1ccc(CCNC(=O)C2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C18H25NO3/c1-2-13-3-5-14(6-4-13)11-12-19-17(20)15-7-9-16(10-8-15)18(21)22/h3-6,15-16H,2,7-12H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | USKXCOMBUBYEPE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |