2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid

C12H16O4S2 — CID 79629843

IUPAC2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid
SMILESCC(C)(CSc1ccc(S(C)(=O)=O)cc1)C(=O)O
InChIInChI=1S/C12H16O4S2/c1-12(2,11(13)14)8-17-9-4-6-10(7-5-9)18(3,15)16/h4-7H,8H2,1-3H3,(H,13,14)
InChIKeyMIKYXSABBVZIFD-UHFFFAOYSA-N
MW288.39 g/mol
LogP2.29
Rot. Bonds5

About 2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid

2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid (PubChem CID 79629843) has the molecular formula C12H16O4S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid.

Molecular Properties

Compound Name2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid
PubChem CID79629843
Molecular FormulaC12H16O4S2
Molecular Weight288.39 g/mol
Exact Mass288.05
IUPAC Name2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid
SMILESCC(C)(CSc1ccc(S(C)(=O)=O)cc1)C(=O)O
InChIInChI=1S/C12H16O4S2/c1-12(2,11(13)14)8-17-9-4-6-10(7-5-9)18(3,15)16/h4-7H,8H2,1-3H3,(H,13,14)
InChIKeyMIKYXSABBVZIFD-UHFFFAOYSA-N
XLogP2.29
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.39
LogP ≤ 52.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid?
The IUPAC name of 2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid (CID 79629843) is 2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid.
What is the SMILES notation for 2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid?
The canonical SMILES for 2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid is CC(C)(CSc1ccc(S(C)(=O)=O)cc1)C(=O)O.
What is the InChIKey of 2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid?
The InChIKey is MIKYXSABBVZIFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4S2/c1-12(2,11(13)14)8-17-9-4-6-10(7-5-9)18(3,15)16/h4-7H,8H2,1-3H3,(H,13,14).
What are the key properties of 2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid?
2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid has a molecular weight of 288.39 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-(4-methylsulfonylphenyl)sulfanylpropanoic acid is sourced from PubChem (CID 79629843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).