C13H20N2O3S2 — CID 63237795
2-(ethylamino)-2-methyl-3-(4-methylsulfonylphenyl)sulfanylpropanamide (PubChem CID 63237795) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-3-(4-methylsulfonylphenyl)sulfanylpropanamide.
| Compound Name | 2-(ethylamino)-2-methyl-3-(4-methylsulfonylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 63237795 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-(ethylamino)-2-methyl-3-(4-methylsulfonylphenyl)sulfanylpropanamide |
| SMILES | CCNC(C)(CSc1ccc(S(C)(=O)=O)cc1)C(N)=O |
| InChI | InChI=1S/C13H20N2O3S2/c1-4-15-13(2,12(14)16)9-19-10-5-7-11(8-6-10)20(3,17)18/h5-8,15H,4,9H2,1-3H3,(H2,14,16) |
| InChIKey | XTFNEZQSHFLRSX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |