C13H14N2O3S3 — CID 63590993
5-[(4-methylsulfonylphenyl)sulfanylmethyl]thiophene-2-carbohydrazide (PubChem CID 63590993) has the molecular formula C13H14N2O3S3 and a molecular weight of 342.47 g/mol. Its IUPAC name is 5-[(4-methylsulfonylphenyl)sulfanylmethyl]thiophene-2-carbohydrazide.
| Compound Name | 5-[(4-methylsulfonylphenyl)sulfanylmethyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 63590993 |
| Molecular Formula | C13H14N2O3S3 |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 5-[(4-methylsulfonylphenyl)sulfanylmethyl]thiophene-2-carbohydrazide |
| SMILES | CS(=O)(=O)c1ccc(SCc2ccc(C(=O)NN)s2)cc1 |
| InChI | InChI=1S/C13H14N2O3S3/c1-21(17,18)11-5-2-9(3-6-11)19-8-10-4-7-12(20-10)13(16)15-14/h2-7H,8,14H2,1H3,(H,15,16) |
| InChIKey | LZKKTDIUZZPYRM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|