C9H15N3OS2 — CID 66216952
5-(2-aminopropylsulfanylmethyl)thiophene-2-carbohydrazide (PubChem CID 66216952) has the molecular formula C9H15N3OS2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 5-(2-aminopropylsulfanylmethyl)thiophene-2-carbohydrazide.
| Compound Name | 5-(2-aminopropylsulfanylmethyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 66216952 |
| Molecular Formula | C9H15N3OS2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 5-(2-aminopropylsulfanylmethyl)thiophene-2-carbohydrazide |
| SMILES | CC(N)CSCc1ccc(C(=O)NN)s1 |
| InChI | InChI=1S/C9H15N3OS2/c1-6(10)4-14-5-7-2-3-8(15-7)9(13)12-11/h2-3,6H,4-5,10-11H2,1H3,(H,12,13) |
| InChIKey | QNUUNJOSUPVYDJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|