C16H20N2OS2 — CID 63582493
5-[(4-tert-butylphenyl)sulfanylmethyl]thiophene-2-carbohydrazide (PubChem CID 63582493) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)sulfanylmethyl]thiophene-2-carbohydrazide.
| Compound Name | 5-[(4-tert-butylphenyl)sulfanylmethyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 63582493 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 5-[(4-tert-butylphenyl)sulfanylmethyl]thiophene-2-carbohydrazide |
| SMILES | CC(C)(C)c1ccc(SCc2ccc(C(=O)NN)s2)cc1 |
| InChI | InChI=1S/C16H20N2OS2/c1-16(2,3)11-4-6-12(7-5-11)20-10-13-8-9-14(21-13)15(19)18-17/h4-9H,10,17H2,1-3H3,(H,18,19) |
| InChIKey | PMQYOIWWZROVPV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|