C9H10N4OS2 — CID 107782850
5-(1H-imidazol-2-ylsulfanylmethyl)thiophene-2-carbohydrazide (PubChem CID 107782850) has the molecular formula C9H10N4OS2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 5-(1H-imidazol-2-ylsulfanylmethyl)thiophene-2-carbohydrazide.
| Compound Name | 5-(1H-imidazol-2-ylsulfanylmethyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 107782850 |
| Molecular Formula | C9H10N4OS2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 5-(1H-imidazol-2-ylsulfanylmethyl)thiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1ccc(CSc2ncc[nH]2)s1 |
| InChI | InChI=1S/C9H10N4OS2/c10-13-8(14)7-2-1-6(16-7)5-15-9-11-3-4-12-9/h1-4H,5,10H2,(H,11,12)(H,13,14) |
| InChIKey | RDURBIYNGZZFOW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|