C10H11N3OS3 — CID 55212321
5-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiophene-2-carbohydrazide (PubChem CID 55212321) has the molecular formula C10H11N3OS3 and a molecular weight of 285.42 g/mol. Its IUPAC name is 5-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiophene-2-carbohydrazide.
| Compound Name | 5-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55212321 |
| Molecular Formula | C10H11N3OS3 |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 5-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiophene-2-carbohydrazide |
| SMILES | Cc1csc(SCc2ccc(C(=O)NN)s2)n1 |
| InChI | InChI=1S/C10H11N3OS3/c1-6-4-15-10(12-6)16-5-7-2-3-8(17-7)9(14)13-11/h2-4H,5,11H2,1H3,(H,13,14) |
| InChIKey | UQAMORFZOZCMLJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|