C7H11N3OS2 — CID 63582849
3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanehydrazide (PubChem CID 63582849) has the molecular formula C7H11N3OS2 and a molecular weight of 217.32 g/mol. Its IUPAC name is 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanehydrazide.
| Compound Name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanehydrazide |
|---|---|
| PubChem CID | 63582849 |
| Molecular Formula | C7H11N3OS2 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propanehydrazide |
| SMILES | Cc1csc(SCCC(=O)NN)n1 |
| InChI | InChI=1S/C7H11N3OS2/c1-5-4-13-7(9-5)12-3-2-6(11)10-8/h4H,2-3,8H2,1H3,(H,10,11) |
| InChIKey | XNOPTVZFOGRROY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|