C6H9N3OS2 — CID 63581997
3-(1,3-thiazol-2-ylsulfanyl)propanehydrazide (PubChem CID 63581997) has the molecular formula C6H9N3OS2 and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-ylsulfanyl)propanehydrazide.
| Compound Name | 3-(1,3-thiazol-2-ylsulfanyl)propanehydrazide |
|---|---|
| PubChem CID | 63581997 |
| Molecular Formula | C6H9N3OS2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 3-(1,3-thiazol-2-ylsulfanyl)propanehydrazide |
| SMILES | NNC(=O)CCSc1nccs1 |
| InChI | InChI=1S/C6H9N3OS2/c7-9-5(10)1-3-11-6-8-2-4-12-6/h2,4H,1,3,7H2,(H,9,10) |
| InChIKey | ASMRFDYFDKSGKK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|