C13H14FN3OS2 — CID 61218731
N-(3-amino-4-fluorophenyl)-4-(1,3-thiazol-2-ylsulfanyl)butanamide (PubChem CID 61218731) has the molecular formula C13H14FN3OS2 and a molecular weight of 311.41 g/mol. Its IUPAC name is N-(3-amino-4-fluorophenyl)-4-(1,3-thiazol-2-ylsulfanyl)butanamide.
| Compound Name | N-(3-amino-4-fluorophenyl)-4-(1,3-thiazol-2-ylsulfanyl)butanamide |
|---|---|
| PubChem CID | 61218731 |
| Molecular Formula | C13H14FN3OS2 |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-(3-amino-4-fluorophenyl)-4-(1,3-thiazol-2-ylsulfanyl)butanamide |
| SMILES | Nc1cc(NC(=O)CCCSc2nccs2)ccc1F |
| InChI | InChI=1S/C13H14FN3OS2/c14-10-4-3-9(8-11(10)15)17-12(18)2-1-6-19-13-16-5-7-20-13/h3-5,7-8H,1-2,6,15H2,(H,17,18) |
| InChIKey | YEODECIMTOGHEK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|