C15H25FN4O — CID 63695284
N-(3-amino-4-fluorophenyl)-4-[2-(dimethylamino)ethyl-methylamino]butanamide (PubChem CID 63695284) has the molecular formula C15H25FN4O and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(3-amino-4-fluorophenyl)-4-[2-(dimethylamino)ethyl-methylamino]butanamide.
| Compound Name | N-(3-amino-4-fluorophenyl)-4-[2-(dimethylamino)ethyl-methylamino]butanamide |
|---|---|
| PubChem CID | 63695284 |
| Molecular Formula | C15H25FN4O |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | N-(3-amino-4-fluorophenyl)-4-[2-(dimethylamino)ethyl-methylamino]butanamide |
| SMILES | CN(C)CCN(C)CCCC(=O)Nc1ccc(F)c(N)c1 |
| InChI | InChI=1S/C15H25FN4O/c1-19(2)9-10-20(3)8-4-5-15(21)18-12-6-7-13(16)14(17)11-12/h6-7,11H,4-5,8-10,17H2,1-3H3,(H,18,21) |
| InChIKey | OXRWHFCDSNSEBU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|