C14H15FN4OS — CID 63380792
N-(3-amino-4-fluorophenyl)-4-pyrazin-2-ylsulfanylbutanamide (PubChem CID 63380792) has the molecular formula C14H15FN4OS and a molecular weight of 306.37 g/mol. Its IUPAC name is N-(3-amino-4-fluorophenyl)-4-pyrazin-2-ylsulfanylbutanamide.
| Compound Name | N-(3-amino-4-fluorophenyl)-4-pyrazin-2-ylsulfanylbutanamide |
|---|---|
| PubChem CID | 63380792 |
| Molecular Formula | C14H15FN4OS |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-(3-amino-4-fluorophenyl)-4-pyrazin-2-ylsulfanylbutanamide |
| SMILES | Nc1cc(NC(=O)CCCSc2cnccn2)ccc1F |
| InChI | InChI=1S/C14H15FN4OS/c15-11-4-3-10(8-12(11)16)19-13(20)2-1-7-21-14-9-17-5-6-18-14/h3-6,8-9H,1-2,7,16H2,(H,19,20) |
| InChIKey | CVGCCPJKYFKQHW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|