C10H15N3OS — CID 102926020
3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]propanehydrazide (PubChem CID 102926020) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]propanehydrazide.
| Compound Name | 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]propanehydrazide |
|---|---|
| PubChem CID | 102926020 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]propanehydrazide |
| SMILES | Cc1cc(C)nc(SCCC(=O)NN)c1 |
| InChI | InChI=1S/C10H15N3OS/c1-7-5-8(2)12-10(6-7)15-4-3-9(14)13-11/h5-6H,3-4,11H2,1-2H3,(H,13,14) |
| InChIKey | NGXMTDGXJHXPPG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|