About methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate
methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate (PubChem CID 102925738) has the molecular formula C13H20N2O2S
and a molecular weight of 268.38 g/mol. Its IUPAC name is methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate.
Molecular Properties
| Compound Name | methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate |
| PubChem CID | 102925738 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate |
| SMILES | COC(=O)C(C)(N)CCSc1cc(C)cc(C)n1 |
| InChI | InChI=1S/C13H20N2O2S/c1-9-7-10(2)15-11(8-9)18-6-5-13(3,14)12(16)17-4/h7-8H,5-6,14H2,1-4H3 |
| InChIKey | ZIZPUBXTWBCBRA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate?
The IUPAC name of methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate (CID 102925738) is methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate.
What is the SMILES notation for methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate?
The canonical SMILES for methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate is COC(=O)C(C)(N)CCSc1cc(C)cc(C)n1.
What is the InChIKey of methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate?
The InChIKey is ZIZPUBXTWBCBRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2S/c1-9-7-10(2)15-11(8-9)18-6-5-13(3,14)12(16)17-4/h7-8H,5-6,14H2,1-4H3.
What are the key properties of methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate?
methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate has a molecular weight of 268.38 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methylbutanoate is sourced from PubChem (CID 102925738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).