About 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine
5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine (PubChem CID 102925316) has the molecular formula C14H24N2S
and a molecular weight of 252.43 g/mol. Its IUPAC name is 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine |
| PubChem CID | 102925316 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine |
| SMILES | Cc1cc(C)nc(SCCCC(C)(C)CN)c1 |
| InChI | InChI=1S/C14H24N2S/c1-11-8-12(2)16-13(9-11)17-7-5-6-14(3,4)10-15/h8-9H,5-7,10,15H2,1-4H3 |
| InChIKey | CRZVLSGMXBXCCK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine?
The IUPAC name of 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine (CID 102925316) is 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine.
What is the SMILES notation for 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine?
The canonical SMILES for 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine is Cc1cc(C)nc(SCCCC(C)(C)CN)c1.
What is the InChIKey of 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine?
The InChIKey is CRZVLSGMXBXCCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2S/c1-11-8-12(2)16-13(9-11)17-7-5-6-14(3,4)10-15/h8-9H,5-7,10,15H2,1-4H3.
What are the key properties of 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine?
5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine has a molecular weight of 252.43 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine is sourced from PubChem (CID 102925316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).