C12H19BrN2S — CID 65255657
5-[(5-bromo-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine (PubChem CID 65255657) has the molecular formula C12H19BrN2S and a molecular weight of 303.27 g/mol. Its IUPAC name is 5-[(5-bromo-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine.
| Compound Name | 5-[(5-bromo-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 65255657 |
| Molecular Formula | C12H19BrN2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 5-[(5-bromo-2-pyridinyl)sulfanyl]-2,2-dimethylpentan-1-amine |
| SMILES | CC(C)(CN)CCCSc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H19BrN2S/c1-12(2,9-14)6-3-7-16-11-5-4-10(13)8-15-11/h4-5,8H,3,6-7,9,14H2,1-2H3 |
| InChIKey | LHTBMGYKLUWCKG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|