C13H18BrN3S — CID 106805439
5-[(5-bromo-2-pyridinyl)sulfanyl]-2-ethyl-2-(methylamino)pentanenitrile (PubChem CID 106805439) has the molecular formula C13H18BrN3S and a molecular weight of 328.28 g/mol. Its IUPAC name is 5-[(5-bromo-2-pyridinyl)sulfanyl]-2-ethyl-2-(methylamino)pentanenitrile.
| Compound Name | 5-[(5-bromo-2-pyridinyl)sulfanyl]-2-ethyl-2-(methylamino)pentanenitrile |
|---|---|
| PubChem CID | 106805439 |
| Molecular Formula | C13H18BrN3S |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 5-[(5-bromo-2-pyridinyl)sulfanyl]-2-ethyl-2-(methylamino)pentanenitrile |
| SMILES | CCC(C#N)(CCCSc1ccc(Br)cn1)NC |
| InChI | InChI=1S/C13H18BrN3S/c1-3-13(10-15,16-2)7-4-8-18-12-6-5-11(14)9-17-12/h5-6,9,16H,3-4,7-8H2,1-2H3 |
| InChIKey | VINSRUUAZZQMDY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|