C14H18F2N2S — CID 106805046
5-(2,4-difluorophenyl)sulfanyl-2-ethyl-2-(methylamino)pentanenitrile (PubChem CID 106805046) has the molecular formula C14H18F2N2S and a molecular weight of 284.38 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)sulfanyl-2-ethyl-2-(methylamino)pentanenitrile.
| Compound Name | 5-(2,4-difluorophenyl)sulfanyl-2-ethyl-2-(methylamino)pentanenitrile |
|---|---|
| PubChem CID | 106805046 |
| Molecular Formula | C14H18F2N2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 5-(2,4-difluorophenyl)sulfanyl-2-ethyl-2-(methylamino)pentanenitrile |
| SMILES | CCC(C#N)(CCCSc1ccc(F)cc1F)NC |
| InChI | InChI=1S/C14H18F2N2S/c1-3-14(10-17,18-2)7-4-8-19-13-6-5-11(15)9-12(13)16/h5-6,9,18H,3-4,7-8H2,1-2H3 |
| InChIKey | CAZOAZTYBYFVEK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|