C15H20F2N2S — CID 106805243
5-(2,5-difluorophenyl)sulfanyl-2-ethyl-2-(ethylamino)pentanenitrile (PubChem CID 106805243) has the molecular formula C15H20F2N2S and a molecular weight of 298.40 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)sulfanyl-2-ethyl-2-(ethylamino)pentanenitrile.
| Compound Name | 5-(2,5-difluorophenyl)sulfanyl-2-ethyl-2-(ethylamino)pentanenitrile |
|---|---|
| PubChem CID | 106805243 |
| Molecular Formula | C15H20F2N2S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 5-(2,5-difluorophenyl)sulfanyl-2-ethyl-2-(ethylamino)pentanenitrile |
| SMILES | CCNC(C#N)(CC)CCCSc1cc(F)ccc1F |
| InChI | InChI=1S/C15H20F2N2S/c1-3-15(11-18,19-4-2)8-5-9-20-14-10-12(16)6-7-13(14)17/h6-7,10,19H,3-5,8-9H2,1-2H3 |
| InChIKey | HIQJURKPQWEQRR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|