C13H19F2NOS — CID 106811633
3-(aminomethyl)-6-(2,5-difluorophenyl)sulfanylhexan-3-ol (PubChem CID 106811633) has the molecular formula C13H19F2NOS and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-(aminomethyl)-6-(2,5-difluorophenyl)sulfanylhexan-3-ol.
| Compound Name | 3-(aminomethyl)-6-(2,5-difluorophenyl)sulfanylhexan-3-ol |
|---|---|
| PubChem CID | 106811633 |
| Molecular Formula | C13H19F2NOS |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-(aminomethyl)-6-(2,5-difluorophenyl)sulfanylhexan-3-ol |
| SMILES | CCC(O)(CN)CCCSc1cc(F)ccc1F |
| InChI | InChI=1S/C13H19F2NOS/c1-2-13(17,9-16)6-3-7-18-12-8-10(14)4-5-11(12)15/h4-5,8,17H,2-3,6-7,9,16H2,1H3 |
| InChIKey | RPNQRDQICSOPMP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|