C13H18F2N2OS — CID 77063344
5-(2,5-difluorophenyl)sulfanyl-N'-hydroxy-2,2-dimethylpentanimidamide (PubChem CID 77063344) has the molecular formula C13H18F2N2OS and a molecular weight of 288.36 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)sulfanyl-N'-hydroxy-2,2-dimethylpentanimidamide.
| Compound Name | 5-(2,5-difluorophenyl)sulfanyl-N'-hydroxy-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 77063344 |
| Molecular Formula | C13H18F2N2OS |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 5-(2,5-difluorophenyl)sulfanyl-N'-hydroxy-2,2-dimethylpentanimidamide |
| SMILES | CC(C)(CCCSc1cc(F)ccc1F)C(N)=NO |
| InChI | InChI=1S/C13H18F2N2OS/c1-13(2,12(16)17-18)6-3-7-19-11-8-9(14)4-5-10(11)15/h4-5,8,18H,3,6-7H2,1-2H3,(H2,16,17) |
| InChIKey | ZSKCKRONDCBVMU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|