C10H13F2NS — CID 43530759
4-(2,5-difluorophenyl)sulfanylbutan-1-amine (PubChem CID 43530759) has the molecular formula C10H13F2NS and a molecular weight of 217.28 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)sulfanylbutan-1-amine.
| Compound Name | 4-(2,5-difluorophenyl)sulfanylbutan-1-amine |
|---|---|
| PubChem CID | 43530759 |
| Molecular Formula | C10H13F2NS |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 4-(2,5-difluorophenyl)sulfanylbutan-1-amine |
| SMILES | NCCCCSc1cc(F)ccc1F |
| InChI | InChI=1S/C10H13F2NS/c11-8-3-4-9(12)10(7-8)14-6-2-1-5-13/h3-4,7H,1-2,5-6,13H2 |
| InChIKey | INFUIALPPSHDDY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|