C13H17F2NS — CID 62577626
N-[4-(2,5-difluorophenyl)sulfanylbutyl]cyclopropanamine (PubChem CID 62577626) has the molecular formula C13H17F2NS and a molecular weight of 257.35 g/mol. Its IUPAC name is N-[4-(2,5-difluorophenyl)sulfanylbutyl]cyclopropanamine.
| Compound Name | N-[4-(2,5-difluorophenyl)sulfanylbutyl]cyclopropanamine |
|---|---|
| PubChem CID | 62577626 |
| Molecular Formula | C13H17F2NS |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-[4-(2,5-difluorophenyl)sulfanylbutyl]cyclopropanamine |
| SMILES | Fc1ccc(F)c(SCCCCNC2CC2)c1 |
| InChI | InChI=1S/C13H17F2NS/c14-10-3-6-12(15)13(9-10)17-8-2-1-7-16-11-4-5-11/h3,6,9,11,16H,1-2,4-5,7-8H2 |
| InChIKey | IZZNJJGEAIGBCD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|