C15H20FNO — CID 66360716
N-[4-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)butyl]cyclopropanamine (PubChem CID 66360716) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is N-[4-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)butyl]cyclopropanamine.
| Compound Name | N-[4-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)butyl]cyclopropanamine |
|---|---|
| PubChem CID | 66360716 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-[4-(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)butyl]cyclopropanamine |
| SMILES | Fc1ccc2c(c1)CC(CCCCNC1CC1)O2 |
| InChI | InChI=1S/C15H20FNO/c16-12-4-7-15-11(9-12)10-14(18-15)3-1-2-8-17-13-5-6-13/h4,7,9,13-14,17H,1-3,5-6,8,10H2 |
| InChIKey | TUZRFKAOIYXMQE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|