C13H17F2NS — CID 104755477
1-cyclopentyl-2-(2,5-difluorophenyl)sulfanylethanamine (PubChem CID 104755477) has the molecular formula C13H17F2NS and a molecular weight of 257.35 g/mol. Its IUPAC name is 1-cyclopentyl-2-(2,5-difluorophenyl)sulfanylethanamine.
| Compound Name | 1-cyclopentyl-2-(2,5-difluorophenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 104755477 |
| Molecular Formula | C13H17F2NS |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-cyclopentyl-2-(2,5-difluorophenyl)sulfanylethanamine |
| SMILES | NC(CSc1cc(F)ccc1F)C1CCCC1 |
| InChI | InChI=1S/C13H17F2NS/c14-10-5-6-11(15)13(7-10)17-8-12(16)9-3-1-2-4-9/h5-7,9,12H,1-4,8,16H2 |
| InChIKey | LIHUKRMVGXSROX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |