C14H19Cl2NS — CID 104755863
1-cyclohexyl-2-(3,4-dichlorophenyl)sulfanylethanamine (PubChem CID 104755863) has the molecular formula C14H19Cl2NS and a molecular weight of 304.29 g/mol. Its IUPAC name is 1-cyclohexyl-2-(3,4-dichlorophenyl)sulfanylethanamine.
| Compound Name | 1-cyclohexyl-2-(3,4-dichlorophenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 104755863 |
| Molecular Formula | C14H19Cl2NS |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 1-cyclohexyl-2-(3,4-dichlorophenyl)sulfanylethanamine |
| SMILES | NC(CSc1ccc(Cl)c(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C14H19Cl2NS/c15-12-7-6-11(8-13(12)16)18-9-14(17)10-4-2-1-3-5-10/h6-8,10,14H,1-5,9,17H2 |
| InChIKey | TXJVGCNYOLICON-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |