C11H19N3S — CID 104755777
1-cyclopentyl-2-(1-methylpyrazol-4-yl)sulfanylethanamine (PubChem CID 104755777) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 1-cyclopentyl-2-(1-methylpyrazol-4-yl)sulfanylethanamine.
| Compound Name | 1-cyclopentyl-2-(1-methylpyrazol-4-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 104755777 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-cyclopentyl-2-(1-methylpyrazol-4-yl)sulfanylethanamine |
| SMILES | Cn1cc(SCC(N)C2CCCC2)cn1 |
| InChI | InChI=1S/C11H19N3S/c1-14-7-10(6-13-14)15-8-11(12)9-4-2-3-5-9/h6-7,9,11H,2-5,8,12H2,1H3 |
| InChIKey | BOSOHFRTYGVTOG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |