C10H17N3OS — CID 104755787
2-(1-methylpyrazol-4-yl)sulfanyl-1-(oxolan-3-yl)ethanamine (PubChem CID 104755787) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)sulfanyl-1-(oxolan-3-yl)ethanamine.
| Compound Name | 2-(1-methylpyrazol-4-yl)sulfanyl-1-(oxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 104755787 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)sulfanyl-1-(oxolan-3-yl)ethanamine |
| SMILES | Cn1cc(SCC(N)C2CCOC2)cn1 |
| InChI | InChI=1S/C10H17N3OS/c1-13-5-9(4-12-13)15-7-10(11)8-2-3-14-6-8/h4-5,8,10H,2-3,6-7,11H2,1H3 |
| InChIKey | PTZYQIMVUQNBMS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |