C8H15N3OS — CID 64900094
3-amino-4-(1-methylpyrazol-4-yl)sulfanylbutan-1-ol (PubChem CID 64900094) has the molecular formula C8H15N3OS and a molecular weight of 201.29 g/mol. Its IUPAC name is 3-amino-4-(1-methylpyrazol-4-yl)sulfanylbutan-1-ol.
| Compound Name | 3-amino-4-(1-methylpyrazol-4-yl)sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 64900094 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 3-amino-4-(1-methylpyrazol-4-yl)sulfanylbutan-1-ol |
| SMILES | Cn1cc(SCC(N)CCO)cn1 |
| InChI | InChI=1S/C8H15N3OS/c1-11-5-8(4-10-11)13-6-7(9)2-3-12/h4-5,7,12H,2-3,6,9H2,1H3 |
| InChIKey | FMNWZVALYLIUKE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |