C10H19N3OS — CID 61385188
1-(1-methylpyrazol-4-yl)sulfanyl-3-(propylamino)propan-2-ol (PubChem CID 61385188) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)sulfanyl-3-(propylamino)propan-2-ol.
| Compound Name | 1-(1-methylpyrazol-4-yl)sulfanyl-3-(propylamino)propan-2-ol |
|---|---|
| PubChem CID | 61385188 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)sulfanyl-3-(propylamino)propan-2-ol |
| SMILES | CCCNCC(O)CSc1cnn(C)c1 |
| InChI | InChI=1S/C10H19N3OS/c1-3-4-11-5-9(14)8-15-10-6-12-13(2)7-10/h6-7,9,11,14H,3-5,8H2,1-2H3 |
| InChIKey | FVKPGZBHEXHKQN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|