C11H21N3OS — CID 115476348
1-(2-methylpropylamino)-3-(1-methylpyrazol-4-yl)sulfanylpropan-2-ol (PubChem CID 115476348) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 1-(2-methylpropylamino)-3-(1-methylpyrazol-4-yl)sulfanylpropan-2-ol.
| Compound Name | 1-(2-methylpropylamino)-3-(1-methylpyrazol-4-yl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 115476348 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(2-methylpropylamino)-3-(1-methylpyrazol-4-yl)sulfanylpropan-2-ol |
| SMILES | CC(C)CNCC(O)CSc1cnn(C)c1 |
| InChI | InChI=1S/C11H21N3OS/c1-9(2)4-12-5-10(15)8-16-11-6-13-14(3)7-11/h6-7,9-10,12,15H,4-5,8H2,1-3H3 |
| InChIKey | DQUQGLSHGIZBBI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |