C8H12N2O3S — CID 82778475
3-hydroxy-4-(1-methylpyrazol-4-yl)sulfanylbutanoic acid (PubChem CID 82778475) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 3-hydroxy-4-(1-methylpyrazol-4-yl)sulfanylbutanoic acid.
| Compound Name | 3-hydroxy-4-(1-methylpyrazol-4-yl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 82778475 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 3-hydroxy-4-(1-methylpyrazol-4-yl)sulfanylbutanoic acid |
| SMILES | Cn1cc(SCC(O)CC(=O)O)cn1 |
| InChI | InChI=1S/C8H12N2O3S/c1-10-4-7(3-9-10)14-5-6(11)2-8(12)13/h3-4,6,11H,2,5H2,1H3,(H,12,13) |
| InChIKey | WWQRJEYVJXTSAV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |