C7H11N3O2 — CID 28600208
(3R)-3-amino-3-(1-methylpyrazol-4-yl)propanoic acid (PubChem CID 28600208) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is (3R)-3-amino-3-(1-methylpyrazol-4-yl)propanoic acid.
| Compound Name | (3R)-3-amino-3-(1-methylpyrazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 28600208 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (3R)-3-amino-3-(1-methylpyrazol-4-yl)propanoic acid |
| SMILES | Cn1cc([C@H](N)CC(=O)O)cn1 |
| InChI | InChI=1S/C7H11N3O2/c1-10-4-5(3-9-10)6(8)2-7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12)/t6-/m1/s1 |
| InChIKey | UYCBHQKLCHFALG-ZCFIWIBFSA-N |
| XLogP | -0.11 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |