C6H12N4 — CID 93094324
(1R)-1-(1-methylpyrazol-4-yl)ethane-1,2-diamine (PubChem CID 93094324) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is (1R)-1-(1-methylpyrazol-4-yl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(1-methylpyrazol-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 93094324 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | (1R)-1-(1-methylpyrazol-4-yl)ethane-1,2-diamine |
| SMILES | Cn1cc([C@@H](N)CN)cn1 |
| InChI | InChI=1S/C6H12N4/c1-10-4-5(3-9-10)6(8)2-7/h3-4,6H,2,7-8H2,1H3/t6-/m0/s1 |
| InChIKey | HIWAIHBATLLXPU-LURJTMIESA-N |
| XLogP | -0.62 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |