C10H18N4S — CID 115291117
1-(1-methylpyrazol-4-yl)-2-thiomorpholin-4-ylethanamine (PubChem CID 115291117) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)-2-thiomorpholin-4-ylethanamine.
| Compound Name | 1-(1-methylpyrazol-4-yl)-2-thiomorpholin-4-ylethanamine |
|---|---|
| PubChem CID | 115291117 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)-2-thiomorpholin-4-ylethanamine |
| SMILES | Cn1cc(C(N)CN2CCSCC2)cn1 |
| InChI | InChI=1S/C10H18N4S/c1-13-7-9(6-12-13)10(11)8-14-2-4-15-5-3-14/h6-7,10H,2-5,8,11H2,1H3 |
| InChIKey | YNBZHNLYZMXNJO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |