C10H15N5O4 — CID 103870099
(2S)-4-amino-2-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]-4-oxobutanoic acid (PubChem CID 103870099) has the molecular formula C10H15N5O4 and a molecular weight of 269.26 g/mol. Its IUPAC name is (2S)-4-amino-2-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103870099 |
| Molecular Formula | C10H15N5O4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (2S)-4-amino-2-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]-4-oxobutanoic acid |
| SMILES | Cn1cc(C(N)C(=O)N[C@@H](CC(N)=O)C(=O)O)cn1 |
| InChI | InChI=1S/C10H15N5O4/c1-15-4-5(3-13-15)8(12)9(17)14-6(10(18)19)2-7(11)16/h3-4,6,8H,2,12H2,1H3,(H2,11,16)(H,14,17)(H,18,19)/t6-,8?/m0/s1 |
| InChIKey | NCDCGNLARYDTCM-UUEFVBAFSA-N |
| XLogP | -2.14 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |