C11H19N5O2 — CID 106096606
3-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]-3-methylbutanamide (PubChem CID 106096606) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 3-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]-3-methylbutanamide.
| Compound Name | 3-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106096606 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-[[2-amino-2-(1-methylpyrazol-4-yl)acetyl]amino]-3-methylbutanamide |
| SMILES | Cn1cc(C(N)C(=O)NC(C)(C)CC(N)=O)cn1 |
| InChI | InChI=1S/C11H19N5O2/c1-11(2,4-8(12)17)15-10(18)9(13)7-5-14-16(3)6-7/h5-6,9H,4,13H2,1-3H3,(H2,12,17)(H,15,18) |
| InChIKey | MVPVOCCCRYAOEC-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |