C11H10F2OS — CID 63905359
1-cyclopropyl-2-(2,5-difluorophenyl)sulfanylethanone (PubChem CID 63905359) has the molecular formula C11H10F2OS and a molecular weight of 228.26 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,5-difluorophenyl)sulfanylethanone.
| Compound Name | 1-cyclopropyl-2-(2,5-difluorophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 63905359 |
| Molecular Formula | C11H10F2OS |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 1-cyclopropyl-2-(2,5-difluorophenyl)sulfanylethanone |
| SMILES | O=C(CSc1cc(F)ccc1F)C1CC1 |
| InChI | InChI=1S/C11H10F2OS/c12-8-3-4-9(13)11(5-8)15-6-10(14)7-1-2-7/h3-5,7H,1-2,6H2 |
| InChIKey | VZKREXJJEHCBAY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |